raaeraae22
raaeraae22 raaeraae22
  • 04-02-2017
  • Chemistry
contestada

When is di- used in the name of a hydrocarbon?

Respuesta :

DoctorCass
DoctorCass DoctorCass
  • 04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link

Otras preguntas

The combination of sulfur dioxide, nitrogen oxide, and atmospheric moisture creates A. drinking water. B. smog. C. acid rain. D. pesticides.
Explain one way that ethnic groups in the US and Canada are similar in one way that they are different
Three students share 5 peaches equally. How many peaches does each student get?
what's the fewest number of faces a polyhedron can have?
Which word correctly completes the sentence? An __________ design influences the materials the builder will use. A. architects B. architects'
Three students share 5 peaches equally. How many peaches does each student get?
how do i solve 1-6Log(6x-7)=13 ????
1 divided by 4 ^x = 16 what is x
Which of the following is NOT a way of participating in the political process? A) Writing to your representative B) Displaying a bumper sticker C) Signing a pet
what is the value of 62 tens