hfjdjakkz99 hfjdjakkz99

02-04-2020
English

contestada

What is the most remarkable thing about Jane Goodall you discovered in her biography?

Respuesta :

kingguy90 kingguy90

02-04-2020

Answer:

idk sorry

Explanation:

Answer Link

Otras preguntas

Examine the given reaction. NH4NO3(s) → NH4+(aq) + NO3–(aq) ΔH° = 25.45 kJ/mol ΔS° = 108.7 J/mol·K Which of the given is correct about the ΔG° at 25 °C?A)+4,360

Match the type of market structure with each example.OligopolyOnline auctioningPure competitionCable companyMonopolyGas stationsMonopolisticcompetitionAirlines

Remove all perfect squares from inside the square root√ 72

The net of a right rectangular prism is shown below: Find the volume of the prism with the given net (in cubic inches).

Please answer answer question now

Explain why human being is regarded as a complex machine.

can someone help mewhat is wrong with the statement“we breath in only oxygen and breath out only carbon dioxide”

Modernity has largely led to the collapse of strong marital ties and subsequently affected the choice of mates. Critically provide a four (4)- point coherent a

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

A baseball weights 1429 (0.142kg) were striked with force of 120N. Calculate its acceleration at that time. Include the correct unit with your answer. Include